C28H42N6 — CID 143631475
ethane;N-methylpropan-2-imine;2-methyl-N,N,N'-tris(pyridin-2-ylmethyl)propane-1,3-diamine (PubChem CID 143631475) has the molecular formula C28H42N6 and a molecular weight of 462.69 g/mol. Its IUPAC name is ethane;N-methylpropan-2-imine;2-methyl-N,N,N'-tris(pyridin-2-ylmethyl)propane-1,3-diamine.
| Compound Name | ethane;N-methylpropan-2-imine;2-methyl-N,N,N'-tris(pyridin-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 143631475 |
| Molecular Formula | C28H42N6 |
| Molecular Weight | 462.69 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | ethane;N-methylpropan-2-imine;2-methyl-N,N,N'-tris(pyridin-2-ylmethyl)propane-1,3-diamine |
| SMILES | CC.CC(CNCc1ccccn1)CN(Cc1ccccn1)Cc1ccccn1.CN=C(C)C |
| InChI | InChI=1S/C22H27N5.C4H9N.C2H6/c1-19(14-23-15-20-8-2-5-11-24-20)16-27(17-21-9-3-6-12-25-21)18-22-10-4-7-13-26-22;1-4(2)5-3;1-2/h2-13,19,23H,14-18H2,1H3;1-3H3;1-2H3 |
| InChIKey | YGJLIXGDSQHERX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|