C17H29N3O3 — CID 105007225
tert-butyl N-[1-[(6-methoxy-3-pyridinyl)methylamino]-3-methylbutan-2-yl]carbamate (PubChem CID 105007225) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl N-[1-[(6-methoxy-3-pyridinyl)methylamino]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(6-methoxy-3-pyridinyl)methylamino]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 105007225 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl N-[1-[(6-methoxy-3-pyridinyl)methylamino]-3-methylbutan-2-yl]carbamate |
| SMILES | COc1ccc(CNCC(NC(=O)OC(C)(C)C)C(C)C)cn1 |
| InChI | InChI=1S/C17H29N3O3/c1-12(2)14(20-16(21)23-17(3,4)5)11-18-9-13-7-8-15(22-6)19-10-13/h7-8,10,12,14,18H,9,11H2,1-6H3,(H,20,21) |
| InChIKey | UFJTZBPOGNJKOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |