C19H30N2O4 — CID 113352366
methyl 2-[[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]methyl]benzoate (PubChem CID 113352366) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 2-[[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]methyl]benzoate.
| Compound Name | methyl 2-[[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 113352366 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | methyl 2-[[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CNCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H30N2O4/c1-13(2)16(21-18(23)25-19(3,4)5)12-20-11-14-9-7-8-10-15(14)17(22)24-6/h7-10,13,16,20H,11-12H2,1-6H3,(H,21,23) |
| InChIKey | YKAJAPVJBNGNOH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |