C14H23FN2O2S2 — CID 106082337
4-(ethylaminomethyl)-2-fluoro-N-(3-methylsulfanylbutyl)benzenesulfonamide (PubChem CID 106082337) has the molecular formula C14H23FN2O2S2 and a molecular weight of 334.48 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-2-fluoro-N-(3-methylsulfanylbutyl)benzenesulfonamide.
| Compound Name | 4-(ethylaminomethyl)-2-fluoro-N-(3-methylsulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106082337 |
| Molecular Formula | C14H23FN2O2S2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-(ethylaminomethyl)-2-fluoro-N-(3-methylsulfanylbutyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCCC(C)SC)c(F)c1 |
| InChI | InChI=1S/C14H23FN2O2S2/c1-4-16-10-12-5-6-14(13(15)9-12)21(18,19)17-8-7-11(2)20-3/h5-6,9,11,16-17H,4,7-8,10H2,1-3H3 |
| InChIKey | KNYLHGTXSYTIHE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |