C14H23BrN2O2S2 — CID 106082274
2-bromo-4-(ethylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide (PubChem CID 106082274) has the molecular formula C14H23BrN2O2S2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 2-bromo-4-(ethylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-(ethylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106082274 |
| Molecular Formula | C14H23BrN2O2S2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-bromo-4-(ethylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCCC(C)SC)c(Br)c1 |
| InChI | InChI=1S/C14H23BrN2O2S2/c1-4-16-10-12-5-6-14(13(15)9-12)21(18,19)17-8-7-11(2)20-3/h5-6,9,11,16-17H,4,7-8,10H2,1-3H3 |
| InChIKey | QJFXVFKULGFIKY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |