C12H17BrF2N2O2S — CID 115409236
2-bromo-N-(2,2-difluoroethyl)-4-(propylaminomethyl)benzenesulfonamide (PubChem CID 115409236) has the molecular formula C12H17BrF2N2O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoroethyl)-4-(propylaminomethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-(2,2-difluoroethyl)-4-(propylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115409236 |
| Molecular Formula | C12H17BrF2N2O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2-bromo-N-(2,2-difluoroethyl)-4-(propylaminomethyl)benzenesulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)NCC(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H17BrF2N2O2S/c1-2-5-16-7-9-3-4-11(10(13)6-9)20(18,19)17-8-12(14)15/h3-4,6,12,16-17H,2,5,7-8H2,1H3 |
| InChIKey | JQPRSGOCJZZKEK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|