C14H24BrN3O2S — CID 106032753
2-bromo-N-[2-(dimethylamino)ethyl]-5-(propylaminomethyl)benzenesulfonamide (PubChem CID 106032753) has the molecular formula C14H24BrN3O2S and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-bromo-N-[2-(dimethylamino)ethyl]-5-(propylaminomethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(dimethylamino)ethyl]-5-(propylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106032753 |
| Molecular Formula | C14H24BrN3O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-bromo-N-[2-(dimethylamino)ethyl]-5-(propylaminomethyl)benzenesulfonamide |
| SMILES | CCCNCc1ccc(Br)c(S(=O)(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C14H24BrN3O2S/c1-4-7-16-11-12-5-6-13(15)14(10-12)21(19,20)17-8-9-18(2)3/h5-6,10,16-17H,4,7-9,11H2,1-3H3 |
| InChIKey | ZPUBGXWBYYQJCV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|