C14H25N3O2S — CID 106074662
2-ethyl-N',N'-dimethyl-5-(propylaminomethyl)benzenesulfonohydrazide (PubChem CID 106074662) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-ethyl-N',N'-dimethyl-5-(propylaminomethyl)benzenesulfonohydrazide.
| Compound Name | 2-ethyl-N',N'-dimethyl-5-(propylaminomethyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 106074662 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-ethyl-N',N'-dimethyl-5-(propylaminomethyl)benzenesulfonohydrazide |
| SMILES | CCCNCc1ccc(CC)c(S(=O)(=O)NN(C)C)c1 |
| InChI | InChI=1S/C14H25N3O2S/c1-5-9-15-11-12-7-8-13(6-2)14(10-12)20(18,19)16-17(3)4/h7-8,10,15-16H,5-6,9,11H2,1-4H3 |
| InChIKey | SDRYQZWZUBPJJZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|