C13H21N3O2S — CID 106074932
5-[(cyclopropylamino)methyl]-N',N',2-trimethylbenzenesulfonohydrazide (PubChem CID 106074932) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N',N',2-trimethylbenzenesulfonohydrazide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N',N',2-trimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 106074932 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N',N',2-trimethylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(CNC2CC2)cc1S(=O)(=O)NN(C)C |
| InChI | InChI=1S/C13H21N3O2S/c1-10-4-5-11(9-14-12-6-7-12)8-13(10)19(17,18)15-16(2)3/h4-5,8,12,14-15H,6-7,9H2,1-3H3 |
| InChIKey | BBXIKZGTAFOWJQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|