C16H22N2O2S — CID 114413951
N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methylphenyl]methyl]cyclopropanamine (PubChem CID 114413951) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methylphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methylphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114413951 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[[3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-4-methylphenyl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(CNC2CC2)cc1S(=O)(=O)N1CC=CCC1 |
| InChI | InChI=1S/C16H22N2O2S/c1-13-5-6-14(12-17-15-7-8-15)11-16(13)21(19,20)18-9-3-2-4-10-18/h2-3,5-6,11,15,17H,4,7-10,12H2,1H3 |
| InChIKey | CJNYNXZDKUQPMB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|