C10H17N3O2S2 — CID 106074767
5-[(cyclopropylamino)methyl]-N',N'-dimethylthiophene-3-sulfonohydrazide (PubChem CID 106074767) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N',N'-dimethylthiophene-3-sulfonohydrazide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N',N'-dimethylthiophene-3-sulfonohydrazide |
|---|---|
| PubChem CID | 106074767 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N',N'-dimethylthiophene-3-sulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1csc(CNC2CC2)c1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-13(2)12-17(14,15)10-5-9(16-7-10)6-11-8-3-4-8/h5,7-8,11-12H,3-4,6H2,1-2H3 |
| InChIKey | HVKLGRFWDOSZBO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|