C13H20N2O2S3 — CID 106084390
5-[(cyclopropylamino)methyl]-N-(thian-4-yl)thiophene-3-sulfonamide (PubChem CID 106084390) has the molecular formula C13H20N2O2S3 and a molecular weight of 332.52 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(thian-4-yl)thiophene-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(thian-4-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106084390 |
| Molecular Formula | C13H20N2O2S3 |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(thian-4-yl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCSCC1)c1csc(CNC2CC2)c1 |
| InChI | InChI=1S/C13H20N2O2S3/c16-20(17,15-11-3-5-18-6-4-11)13-7-12(19-9-13)8-14-10-1-2-10/h7,9-11,14-15H,1-6,8H2 |
| InChIKey | HUGBGLDGPUOFRH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |