C14H15IN2O2S2 — CID 106029625
5-[(cyclopropylamino)methyl]-N-(4-iodophenyl)thiophene-3-sulfonamide (PubChem CID 106029625) has the molecular formula C14H15IN2O2S2 and a molecular weight of 434.32 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(4-iodophenyl)thiophene-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(4-iodophenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106029625 |
| Molecular Formula | C14H15IN2O2S2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(4-iodophenyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(I)cc1)c1csc(CNC2CC2)c1 |
| InChI | InChI=1S/C14H15IN2O2S2/c15-10-1-3-12(4-2-10)17-21(18,19)14-7-13(20-9-14)8-16-11-5-6-11/h1-4,7,9,11,16-17H,5-6,8H2 |
| InChIKey | NBKGEJLIWPMQJC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|