C15H27N3O2S — CID 106032666
N-[2-(dimethylamino)ethyl]-2-ethyl-5-(ethylaminomethyl)benzenesulfonamide (PubChem CID 106032666) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-ethyl-5-(ethylaminomethyl)benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-ethyl-5-(ethylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106032666 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-ethyl-5-(ethylaminomethyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(CC)c(S(=O)(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C15H27N3O2S/c1-5-14-8-7-13(12-16-6-2)11-15(14)21(19,20)17-9-10-18(3)4/h7-8,11,16-17H,5-6,9-10,12H2,1-4H3 |
| InChIKey | CYLIYACCMHAVKJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |