C12H16Cl2F2N2O2S — CID 115409045
2,5-dichloro-N-(2,2-difluoroethyl)-3-(propylaminomethyl)benzenesulfonamide (PubChem CID 115409045) has the molecular formula C12H16Cl2F2N2O2S and a molecular weight of 361.24 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,2-difluoroethyl)-3-(propylaminomethyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2,2-difluoroethyl)-3-(propylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115409045 |
| Molecular Formula | C12H16Cl2F2N2O2S |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2,5-dichloro-N-(2,2-difluoroethyl)-3-(propylaminomethyl)benzenesulfonamide |
| SMILES | CCCNCc1cc(Cl)cc(S(=O)(=O)NCC(F)F)c1Cl |
| InChI | InChI=1S/C12H16Cl2F2N2O2S/c1-2-3-17-6-8-4-9(13)5-10(12(8)14)21(19,20)18-7-11(15)16/h4-5,11,17-18H,2-3,6-7H2,1H3 |
| InChIKey | HDQVITIQBMNJAB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|