C14H23FN2O2S2 — CID 106082235
3-fluoro-2-methyl-5-(methylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide (PubChem CID 106082235) has the molecular formula C14H23FN2O2S2 and a molecular weight of 334.48 g/mol. Its IUPAC name is 3-fluoro-2-methyl-5-(methylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide.
| Compound Name | 3-fluoro-2-methyl-5-(methylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106082235 |
| Molecular Formula | C14H23FN2O2S2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-fluoro-2-methyl-5-(methylaminomethyl)-N-(3-methylsulfanylbutyl)benzenesulfonamide |
| SMILES | CNCc1cc(F)c(C)c(S(=O)(=O)NCCC(C)SC)c1 |
| InChI | InChI=1S/C14H23FN2O2S2/c1-10(20-4)5-6-17-21(18,19)14-8-12(9-16-3)7-13(15)11(14)2/h7-8,10,16-17H,5-6,9H2,1-4H3 |
| InChIKey | LJGKLUKJOZCHIL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |