C14H21FN2O2S2 — CID 106063778
5-[(cyclopropylamino)methyl]-3-fluoro-2-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 106063778) has the molecular formula C14H21FN2O2S2 and a molecular weight of 332.47 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-3-fluoro-2-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-3-fluoro-2-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106063778 |
| Molecular Formula | C14H21FN2O2S2 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-3-fluoro-2-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCNS(=O)(=O)c1cc(CNC2CC2)cc(F)c1C |
| InChI | InChI=1S/C14H21FN2O2S2/c1-10-13(15)7-11(9-16-12-3-4-12)8-14(10)21(18,19)17-5-6-20-2/h7-8,12,16-17H,3-6,9H2,1-2H3 |
| InChIKey | VTLXGNFPWQZGNY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|