C12H14FN3O3S — CID 60845886
2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]propanamide (PubChem CID 60845886) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]propanamide.
| Compound Name | 2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 60845886 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[[2-(3-aminoprop-1-ynyl)-4-fluorophenyl]sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)cc1C#CCN)C(N)=O |
| InChI | InChI=1S/C12H14FN3O3S/c1-8(12(15)17)16-20(18,19)11-5-4-10(13)7-9(11)3-2-6-14/h4-5,7-8,16H,6,14H2,1H3,(H2,15,17) |
| InChIKey | KXXWEQCDSWZALO-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|