C13H16N2O4S — CID 60863085
4-[[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]butanamide (PubChem CID 60863085) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]butanamide.
| Compound Name | 4-[[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 60863085 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]butanamide |
| SMILES | NC(=O)CCCNS(=O)(=O)c1ccccc1C#CCO |
| InChI | InChI=1S/C13H16N2O4S/c14-13(17)8-3-9-15-20(18,19)12-7-2-1-5-11(12)6-4-10-16/h1-2,5,7,15-16H,3,8-10H2,(H2,14,17) |
| InChIKey | SIFDPUXHDLKKQG-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|