C13H15N3O3 — CID 83115719
N-[2-(carbamoylamino)ethyl]-2-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 83115719) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 83115719 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | NC(=O)NCCNC(=O)c1ccccc1C#CCO |
| InChI | InChI=1S/C13H15N3O3/c14-13(19)16-8-7-15-12(18)11-6-2-1-4-10(11)5-3-9-17/h1-2,4,6,17H,7-9H2,(H,15,18)(H3,14,16,19) |
| InChIKey | BREDSIXHPSHSEQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|