C14H18N2O4S — CID 106342056
2-(3-hydroxyprop-1-ynyl)-N-[3-(methanesulfonamido)propyl]benzamide (PubChem CID 106342056) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(3-hydroxyprop-1-ynyl)-N-[3-(methanesulfonamido)propyl]benzamide.
| Compound Name | 2-(3-hydroxyprop-1-ynyl)-N-[3-(methanesulfonamido)propyl]benzamide |
|---|---|
| PubChem CID | 106342056 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(3-hydroxyprop-1-ynyl)-N-[3-(methanesulfonamido)propyl]benzamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)c1ccccc1C#CCO |
| InChI | InChI=1S/C14H18N2O4S/c1-21(19,20)16-10-5-9-15-14(18)13-8-3-2-6-12(13)7-4-11-17/h2-3,6,8,16-17H,5,9-11H2,1H3,(H,15,18) |
| InChIKey | LJYQIECQQXMZNN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|