C14H19NO3S2 — CID 63963966
2-(3-hydroxyprop-1-ynyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 63963966) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-(3-hydroxyprop-1-ynyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 2-(3-hydroxyprop-1-ynyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63963966 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(3-hydroxyprop-1-ynyl)-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1ccccc1C#CCO |
| InChI | InChI=1S/C14H19NO3S2/c1-12(11-19-2)10-15-20(17,18)14-8-4-3-6-13(14)7-5-9-16/h3-4,6,8,12,15-16H,9-11H2,1-2H3 |
| InChIKey | GZIRIWKSHKPDJY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|