C10H13NO7S — CID 54907359
5-(1,4-dioxan-2-ylmethylsulfamoyl)furan-2-carboxylic acid (PubChem CID 54907359) has the molecular formula C10H13NO7S and a molecular weight of 291.28 g/mol. Its IUPAC name is 5-(1,4-dioxan-2-ylmethylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-(1,4-dioxan-2-ylmethylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 54907359 |
| Molecular Formula | C10H13NO7S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 5-(1,4-dioxan-2-ylmethylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCC2COCCO2)o1 |
| InChI | InChI=1S/C10H13NO7S/c12-10(13)8-1-2-9(18-8)19(14,15)11-5-7-6-16-3-4-17-7/h1-2,7,11H,3-6H2,(H,12,13) |
| InChIKey | GXTIUNYCXPEVTE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |