C9H12N2O6S — CID 83004785
5-(morpholin-4-ylsulfamoyl)furan-2-carboxylic acid (PubChem CID 83004785) has the molecular formula C9H12N2O6S and a molecular weight of 276.27 g/mol. Its IUPAC name is 5-(morpholin-4-ylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-(morpholin-4-ylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 83004785 |
| Molecular Formula | C9H12N2O6S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 5-(morpholin-4-ylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NN2CCOCC2)o1 |
| InChI | InChI=1S/C9H12N2O6S/c12-9(13)7-1-2-8(17-7)18(14,15)10-11-3-5-16-6-4-11/h1-2,10H,3-6H2,(H,12,13) |
| InChIKey | JEMNANIXJGTXAM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |