C9H12N2O5S2 — CID 83004371
5-(morpholin-4-ylsulfamoyl)thiophene-3-carboxylic acid (PubChem CID 83004371) has the molecular formula C9H12N2O5S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-(morpholin-4-ylsulfamoyl)thiophene-3-carboxylic acid.
| Compound Name | 5-(morpholin-4-ylsulfamoyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 83004371 |
| Molecular Formula | C9H12N2O5S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 5-(morpholin-4-ylsulfamoyl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(S(=O)(=O)NN2CCOCC2)c1 |
| InChI | InChI=1S/C9H12N2O5S2/c12-9(13)7-5-8(17-6-7)18(14,15)10-11-1-3-16-4-2-11/h5-6,10H,1-4H2,(H,12,13) |
| InChIKey | UCHXSIVIYGYGRK-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |