C10H15N3O4S2 — CID 78913710
5-[(4-methylpiperazin-1-yl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 78913710) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-[(4-methylpiperazin-1-yl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[(4-methylpiperazin-1-yl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 78913710 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-[(4-methylpiperazin-1-yl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CN1CCN(NS(=O)(=O)c2cc(C(=O)O)cs2)CC1 |
| InChI | InChI=1S/C10H15N3O4S2/c1-12-2-4-13(5-3-12)11-19(16,17)9-6-8(7-18-9)10(14)15/h6-7,11H,2-5H2,1H3,(H,14,15) |
| InChIKey | ZWZAASYSRNTWPW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |