C18H28N2O2S2 — CID 42193248
1-phenyl-N-[[(3S)-1-(thian-4-yl)piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 42193248) has the molecular formula C18H28N2O2S2 and a molecular weight of 368.57 g/mol. Its IUPAC name is 1-phenyl-N-[[(3S)-1-(thian-4-yl)piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | 1-phenyl-N-[[(3S)-1-(thian-4-yl)piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 42193248 |
| Molecular Formula | C18H28N2O2S2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-phenyl-N-[[(3S)-1-(thian-4-yl)piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NC[C@H]1CCCN(C2CCSCC2)C1 |
| InChI | InChI=1S/C18H28N2O2S2/c21-24(22,15-16-5-2-1-3-6-16)19-13-17-7-4-10-20(14-17)18-8-11-23-12-9-18/h1-3,5-6,17-19H,4,7-15H2/t17-/m1/s1 |
| InChIKey | QUXSYXBBCWDOJJ-QGZVFWFLSA-N |
| XLogP | 2.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |