C13H21ClN2O2S — CID 119968538
1-phenyl-N-(piperidin-3-ylmethyl)methanesulfonamide;hydrochloride (PubChem CID 119968538) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is 1-phenyl-N-(piperidin-3-ylmethyl)methanesulfonamide;hydrochloride.
| Compound Name | 1-phenyl-N-(piperidin-3-ylmethyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119968538 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-phenyl-N-(piperidin-3-ylmethyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccccc1)NCC1CCCNC1 |
| InChI | InChI=1S/C13H20N2O2S.ClH/c16-18(17,11-12-5-2-1-3-6-12)15-10-13-7-4-8-14-9-13;/h1-3,5-6,13-15H,4,7-11H2;1H |
| InChIKey | GRQXXXGXHYCAMV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |