C23H31N3O3S2 — CID 100602128
2-methyl-N-[2-methylsulfanyl-5-[(4-piperidin-1-ylphenyl)methylsulfamoyl]phenyl]propanamide (PubChem CID 100602128) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-methyl-N-[2-methylsulfanyl-5-[(4-piperidin-1-ylphenyl)methylsulfamoyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[2-methylsulfanyl-5-[(4-piperidin-1-ylphenyl)methylsulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 100602128 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-methyl-N-[2-methylsulfanyl-5-[(4-piperidin-1-ylphenyl)methylsulfamoyl]phenyl]propanamide |
| SMILES | CSc1ccc(S(=O)(=O)NCc2ccc(N3CCCCC3)cc2)cc1NC(=O)C(C)C |
| InChI | InChI=1S/C23H31N3O3S2/c1-17(2)23(27)25-21-15-20(11-12-22(21)30-3)31(28,29)24-16-18-7-9-19(10-8-18)26-13-5-4-6-14-26/h7-12,15,17,24H,4-6,13-14,16H2,1-3H3,(H,25,27) |
| InChIKey | NHRMTAMVUSVSOT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|