C19H22N4O3S — CID 110405118
2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-dihydrobenzimidazole-5-sulfonamide (PubChem CID 110405118) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-dihydrobenzimidazole-5-sulfonamide.
| Compound Name | 2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-dihydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110405118 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-dihydrobenzimidazole-5-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NCc3ccc(N4CCCCC4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C19H22N4O3S/c24-19-21-17-9-8-16(12-18(17)22-19)27(25,26)20-13-14-4-6-15(7-5-14)23-10-2-1-3-11-23/h4-9,12,20H,1-3,10-11,13H2,(H2,21,22,24) |
| InChIKey | XFRBPJIRYGIXJH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|