C22H30N2O4S2 — CID 100564472
2-methyl-N-[2-methylsulfanyl-5-[2-(4-propylphenoxy)ethylsulfamoyl]phenyl]propanamide (PubChem CID 100564472) has the molecular formula C22H30N2O4S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-methyl-N-[2-methylsulfanyl-5-[2-(4-propylphenoxy)ethylsulfamoyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[2-methylsulfanyl-5-[2-(4-propylphenoxy)ethylsulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 100564472 |
| Molecular Formula | C22H30N2O4S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-methyl-N-[2-methylsulfanyl-5-[2-(4-propylphenoxy)ethylsulfamoyl]phenyl]propanamide |
| SMILES | CCCc1ccc(OCCNS(=O)(=O)c2ccc(SC)c(NC(=O)C(C)C)c2)cc1 |
| InChI | InChI=1S/C22H30N2O4S2/c1-5-6-17-7-9-18(10-8-17)28-14-13-23-30(26,27)19-11-12-21(29-4)20(15-19)24-22(25)16(2)3/h7-12,15-16,23H,5-6,13-14H2,1-4H3,(H,24,25) |
| InChIKey | LAKOPBBKIVHJJK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|