C19H23ClN2O4S2 — CID 100545643
N-[5-[2-(4-chlorophenoxy)ethylsulfamoyl]-2-methylsulfanylphenyl]-2-methylpropanamide (PubChem CID 100545643) has the molecular formula C19H23ClN2O4S2 and a molecular weight of 442.99 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenoxy)ethylsulfamoyl]-2-methylsulfanylphenyl]-2-methylpropanamide.
| Compound Name | N-[5-[2-(4-chlorophenoxy)ethylsulfamoyl]-2-methylsulfanylphenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100545643 |
| Molecular Formula | C19H23ClN2O4S2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-[5-[2-(4-chlorophenoxy)ethylsulfamoyl]-2-methylsulfanylphenyl]-2-methylpropanamide |
| SMILES | CSc1ccc(S(=O)(=O)NCCOc2ccc(Cl)cc2)cc1NC(=O)C(C)C |
| InChI | InChI=1S/C19H23ClN2O4S2/c1-13(2)19(23)22-17-12-16(8-9-18(17)27-3)28(24,25)21-10-11-26-15-6-4-14(20)5-7-15/h4-9,12-13,21H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | XETSCKCBTRKISX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|