C15H24N2O3S2 — CID 133219435
N-[5-(butan-2-ylsulfamoyl)-2-methylsulfanylphenyl]-2-methylpropanamide (PubChem CID 133219435) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[5-(butan-2-ylsulfamoyl)-2-methylsulfanylphenyl]-2-methylpropanamide.
| Compound Name | N-[5-(butan-2-ylsulfamoyl)-2-methylsulfanylphenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 133219435 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[5-(butan-2-ylsulfamoyl)-2-methylsulfanylphenyl]-2-methylpropanamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(SC)c(NC(=O)C(C)C)c1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-6-11(4)17-22(19,20)12-7-8-14(21-5)13(9-12)16-15(18)10(2)3/h7-11,17H,6H2,1-5H3,(H,16,18) |
| InChIKey | KNTBGPLMXFNKAW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |