C17H21ClN4O4S2 — CID 100599159
4-chloro-N-[5-(3-cyclopentyloxypropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100599159) has the molecular formula C17H21ClN4O4S2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 4-chloro-N-[5-(3-cyclopentyloxypropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-(3-cyclopentyloxypropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100599159 |
| Molecular Formula | C17H21ClN4O4S2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 4-chloro-N-[5-(3-cyclopentyloxypropylsulfamoyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)NCCCOC2CCCC2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4O4S2/c18-13-8-6-12(7-9-13)15(23)20-16-21-22-17(27-16)28(24,25)19-10-3-11-26-14-4-1-2-5-14/h6-9,14,19H,1-5,10-11H2,(H,20,21,23) |
| InChIKey | ALDPUCPQZMHYEB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|