C18H24N4O3S4 — CID 100678936
1-(4-methylsulfanylphenyl)sulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 100678936) has the molecular formula C18H24N4O3S4 and a molecular weight of 472.68 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)sulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(4-methylsulfanylphenyl)sulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100678936 |
| Molecular Formula | C18H24N4O3S4 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)sulfonyl-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CSc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3nnc(SC(C)C)s3)CC2)cc1 |
| InChI | InChI=1S/C18H24N4O3S4/c1-12(2)27-18-21-20-17(28-18)19-16(23)13-8-10-22(11-9-13)29(24,25)15-6-4-14(26-3)5-7-15/h4-7,12-13H,8-11H2,1-3H3,(H,19,20,23) |
| InChIKey | WDTNUTZOMYJNMH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|