C16H16FNO2 — CID 8572955
N-(5-fluoro-2-methylphenyl)-4-(methoxymethyl)benzamide (PubChem CID 8572955) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-4-(methoxymethyl)benzamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-4-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 8572955 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-4-(methoxymethyl)benzamide |
| SMILES | COCc1ccc(C(=O)Nc2cc(F)ccc2C)cc1 |
| InChI | InChI=1S/C16H16FNO2/c1-11-3-8-14(17)9-15(11)18-16(19)13-6-4-12(5-7-13)10-20-2/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | XPABWKXEWNTUEP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |