C21H14Cl2N2O7S2 — CID 67970463
3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-4-chlorobenzoic acid (PubChem CID 67970463) has the molecular formula C21H14Cl2N2O7S2 and a molecular weight of 541.39 g/mol. Its IUPAC name is 3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-4-chlorobenzoic acid.
| Compound Name | 3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 67970463 |
| Molecular Formula | C21H14Cl2N2O7S2 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | 3-[[2-(1-benzofuran-2-ylsulfonylamino)-4-chlorophenyl]sulfamoyl]-4-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)Nc2ccc(Cl)cc2NS(=O)(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C21H14Cl2N2O7S2/c22-14-6-8-16(24-33(28,29)19-9-13(21(26)27)5-7-15(19)23)17(11-14)25-34(30,31)20-10-12-3-1-2-4-18(12)32-20/h1-11,24-25H,(H,26,27) |
| InChIKey | JSIAOLPINTXYDZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |