C23H18Cl2N2O5S3 — CID 130472873
N-[5-chloro-2-[(3-chloro-3-methyl-2H-1-benzothiophen-2-yl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide (PubChem CID 130472873) has the molecular formula C23H18Cl2N2O5S3 and a molecular weight of 569.51 g/mol. Its IUPAC name is N-[5-chloro-2-[(3-chloro-3-methyl-2H-1-benzothiophen-2-yl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-chloro-2-[(3-chloro-3-methyl-2H-1-benzothiophen-2-yl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 130472873 |
| Molecular Formula | C23H18Cl2N2O5S3 |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 567.98 |
| IUPAC Name | N-[5-chloro-2-[(3-chloro-3-methyl-2H-1-benzothiophen-2-yl)sulfonylamino]phenyl]-1-benzofuran-2-sulfonamide |
| SMILES | CC1(Cl)c2ccccc2SC1S(=O)(=O)Nc1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H18Cl2N2O5S3/c1-23(25)16-7-3-5-9-20(16)33-22(23)35(30,31)26-17-11-10-15(24)13-18(17)27-34(28,29)21-12-14-6-2-4-8-19(14)32-21/h2-13,22,26-27H,1H3 |
| InChIKey | JCZSOPOKQXTVOQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|