C17H18Cl2N2O4S2 — CID 60532674
4-chloro-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide (PubChem CID 60532674) has the molecular formula C17H18Cl2N2O4S2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 4-chloro-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60532674 |
| Molecular Formula | C17H18Cl2N2O4S2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 4-chloro-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H18Cl2N2O4S2/c1-12-10-13(18)4-7-16(12)26(22,23)20-14-5-6-15(19)17(11-14)27(24,25)21-8-2-3-9-21/h4-7,10-11,20H,2-3,8-9H2,1H3 |
| InChIKey | JIHAOOBLZRWWLA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |