C18H19ClN2O7S2 — CID 55603645
5-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid (PubChem CID 55603645) has the molecular formula C18H19ClN2O7S2 and a molecular weight of 474.94 g/mol. Its IUPAC name is 5-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid.
| Compound Name | 5-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 55603645 |
| Molecular Formula | C18H19ClN2O7S2 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 5-[(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H19ClN2O7S2/c1-11-8-15(22)13(18(23)24)10-16(11)29(25,26)20-12-4-5-14(19)17(9-12)30(27,28)21-6-2-3-7-21/h4-5,8-10,20,22H,2-3,6-7H2,1H3,(H,23,24) |
| InChIKey | VFVAOJKDKJZGSU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |