C14H22O4 — CID 103457152
1-(3,5-dimethoxyphenyl)-3,3-dimethylbutane-1,2-diol (PubChem CID 103457152) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3,3-dimethylbutane-1,2-diol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3,3-dimethylbutane-1,2-diol |
|---|---|
| PubChem CID | 103457152 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3,3-dimethylbutane-1,2-diol |
| SMILES | COc1cc(OC)cc(C(O)C(O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22O4/c1-14(2,3)13(16)12(15)9-6-10(17-4)8-11(7-9)18-5/h6-8,12-13,15-16H,1-5H3 |
| InChIKey | DTQWVMPIOPNZIW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |