C12H16O3 — CID 117297692
1-[(3,5-dimethoxyphenyl)methyl]cyclopropan-1-ol (PubChem CID 117297692) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117297692 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]cyclopropan-1-ol |
| SMILES | COc1cc(CC2(O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C12H16O3/c1-14-10-5-9(6-11(7-10)15-2)8-12(13)3-4-12/h5-7,13H,3-4,8H2,1-2H3 |
| InChIKey | NZHTXGSXAVKCPQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |