C17H18O2 — CID 65147763
2-[(3-methoxyphenyl)methyl]-1,3-dihydroinden-2-ol (PubChem CID 65147763) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]-1,3-dihydroinden-2-ol.
| Compound Name | 2-[(3-methoxyphenyl)methyl]-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 65147763 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]-1,3-dihydroinden-2-ol |
| SMILES | COc1cccc(CC2(O)Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C17H18O2/c1-19-16-8-4-5-13(9-16)10-17(18)11-14-6-2-3-7-15(14)12-17/h2-9,18H,10-12H2,1H3 |
| InChIKey | SUWWRKIECAVXTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |