C18H19BrO3 — CID 125481616
(1R)-7-bromo-1-[(3,5-dimethoxyphenyl)methyl]-2,3-dihydroinden-1-ol (PubChem CID 125481616) has the molecular formula C18H19BrO3 and a molecular weight of 363.25 g/mol. Its IUPAC name is (1R)-7-bromo-1-[(3,5-dimethoxyphenyl)methyl]-2,3-dihydroinden-1-ol.
| Compound Name | (1R)-7-bromo-1-[(3,5-dimethoxyphenyl)methyl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 125481616 |
| Molecular Formula | C18H19BrO3 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (1R)-7-bromo-1-[(3,5-dimethoxyphenyl)methyl]-2,3-dihydroinden-1-ol |
| SMILES | COc1cc(C[C@]2(O)CCc3cccc(Br)c32)cc(OC)c1 |
| InChI | InChI=1S/C18H19BrO3/c1-21-14-8-12(9-15(10-14)22-2)11-18(20)7-6-13-4-3-5-16(19)17(13)18/h3-5,8-10,20H,6-7,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZLSQCTVQRFCPEN-GOSISDBHSA-N |
| XLogP | 3.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |