C21H33NO2 — CID 21485521
6-(3-ethoxy-4-propoxyphenyl)-N,N-diethylhex-2-yn-1-amine (PubChem CID 21485521) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 6-(3-ethoxy-4-propoxyphenyl)-N,N-diethylhex-2-yn-1-amine.
| Compound Name | 6-(3-ethoxy-4-propoxyphenyl)-N,N-diethylhex-2-yn-1-amine |
|---|---|
| PubChem CID | 21485521 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 6-(3-ethoxy-4-propoxyphenyl)-N,N-diethylhex-2-yn-1-amine |
| SMILES | CCCOc1ccc(CCCC#CCN(CC)CC)cc1OCC |
| InChI | InChI=1S/C21H33NO2/c1-5-17-24-20-15-14-19(18-21(20)23-8-4)13-11-9-10-12-16-22(6-2)7-3/h14-15,18H,5-9,11,13,16-17H2,1-4H3 |
| InChIKey | SULRUBFLQFXWFG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|