C20H31NO — CID 21485690
N,N-diethyloct-2-yn-1-amine;2-ethoxybicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 21485690) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is N,N-diethyloct-2-yn-1-amine;2-ethoxybicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | N,N-diethyloct-2-yn-1-amine;2-ethoxybicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 21485690 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N,N-diethyloct-2-yn-1-amine;2-ethoxybicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | CCCCCC#CCN(CC)CC.CCOc1ccc2cc1-2 |
| InChI | InChI=1S/C12H23N.C8H8O/c1-4-7-8-9-10-11-12-13(5-2)6-3;1-2-9-8-4-3-6-5-7(6)8/h4-9,12H2,1-3H3;3-5H,2H2,1H3 |
| InChIKey | CKWNJVPLNZGSDG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|