C23H28O3SSi — CID 11683048
1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-yn-1-one (PubChem CID 11683048) has the molecular formula C23H28O3SSi and a molecular weight of 412.63 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-yn-1-one.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 11683048 |
| Molecular Formula | C23H28O3SSi |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-yn-1-one |
| SMILES | COc1cc(C(=O)C#Cc2ccc(SC)cc2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H28O3SSi/c1-23(2,3)28(6,7)26-21-15-11-18(16-22(21)25-4)20(24)14-10-17-8-12-19(27-5)13-9-17/h8-9,11-13,15-16H,1-7H3 |
| InChIKey | QHWCLJSXUMFDCC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|