C21H22O10 — CID 162933676
3-[3,4-dihydroxy-5-(2-hydroxyethyl)-2-(hydroxymethyl)phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid (PubChem CID 162933676) has the molecular formula C21H22O10 and a molecular weight of 434.40 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-5-(2-hydroxyethyl)-2-(hydroxymethyl)phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid.
| Compound Name | 3-[3,4-dihydroxy-5-(2-hydroxyethyl)-2-(hydroxymethyl)phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid |
|---|---|
| PubChem CID | 162933676 |
| Molecular Formula | C21H22O10 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 3-[3,4-dihydroxy-5-(2-hydroxyethyl)-2-(hydroxymethyl)phenyl]-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC(Cc1cc(CCO)c(O)c(O)c1CO)C(=O)O |
| InChI | InChI=1S/C21H22O10/c22-6-5-12-8-13(14(10-23)20(28)19(12)27)9-17(21(29)30)31-18(26)4-2-11-1-3-15(24)16(25)7-11/h1-4,7-8,17,22-25,27-28H,5-6,9-10H2,(H,29,30) |
| InChIKey | OEOXLIKYYXNOGC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|