4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid

C10H14O4P2 — CID 143209625

IUPAC4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid
SMILESCOc1cc(/C=C/PP)ccc1O.O=CO
InChIInChI=1S/C9H12O2P2.CH2O2/c1-11-9-6-7(4-5-13-12)2-3-8(9)10;2-1-3/h2-6,10,13H,12H2,1H3;1H,(H,2,3)/b5-4+;
InChIKeyYJTGRKYXYWHDOV-FXRZFVDSSA-N
MW260.17 g/mol
LogP2.54
Rot. Bonds3

About 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid

4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid (PubChem CID 143209625) has the molecular formula C10H14O4P2 and a molecular weight of 260.17 g/mol. Its IUPAC name is 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid.

Molecular Properties

Compound Name4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid
PubChem CID143209625
Molecular FormulaC10H14O4P2
Molecular Weight260.17 g/mol
Exact Mass260.04
IUPAC Name4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid
SMILESCOc1cc(/C=C/PP)ccc1O.O=CO
InChIInChI=1S/C9H12O2P2.CH2O2/c1-11-9-6-7(4-5-13-12)2-3-8(9)10;2-1-3/h2-6,10,13H,12H2,1H3;1H,(H,2,3)/b5-4+;
InChIKeyYJTGRKYXYWHDOV-FXRZFVDSSA-N
XLogP2.54
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.17
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid?
The IUPAC name of 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid (CID 143209625) is 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid.
What is the SMILES notation for 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid?
The canonical SMILES for 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid is COc1cc(/C=C/PP)ccc1O.O=CO.
What is the InChIKey of 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid?
The InChIKey is YJTGRKYXYWHDOV-FXRZFVDSSA-N. The full InChI is InChI=1S/C9H12O2P2.CH2O2/c1-11-9-6-7(4-5-13-12)2-3-8(9)10;2-1-3/h2-6,10,13H,12H2,1H3;1H,(H,2,3)/b5-4+;.
What are the key properties of 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid?
4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid has a molecular weight of 260.17 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid is sourced from PubChem (CID 143209625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).