C10H14O4P2 — CID 143209625
4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid (PubChem CID 143209625) has the molecular formula C10H14O4P2 and a molecular weight of 260.17 g/mol. Its IUPAC name is 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid.
| Compound Name | 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid |
|---|---|
| PubChem CID | 143209625 |
| Molecular Formula | C10H14O4P2 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-[(E)-2-(diphosphanyl)ethenyl]-2-methoxyphenol;formic acid |
| SMILES | COc1cc(/C=C/PP)ccc1O.O=CO |
| InChI | InChI=1S/C9H12O2P2.CH2O2/c1-11-9-6-7(4-5-13-12)2-3-8(9)10;2-1-3/h2-6,10,13H,12H2,1H3;1H,(H,2,3)/b5-4+; |
| InChIKey | YJTGRKYXYWHDOV-FXRZFVDSSA-N |
| XLogP | 2.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|