C22H29ClN4O5 — CID 22877904
(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;(2S)-2-aminopropanamide;hydrochloride (PubChem CID 22877904) has the molecular formula C22H29ClN4O5 and a molecular weight of 464.95 g/mol. Its IUPAC name is (E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;(2S)-2-aminopropanamide;hydrochloride.
| Compound Name | (E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;(2S)-2-aminopropanamide;hydrochloride |
|---|---|
| PubChem CID | 22877904 |
| Molecular Formula | C22H29ClN4O5 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;(2S)-2-aminopropanamide;hydrochloride |
| SMILES | COc1ccc(/C=C(/C#N)c2cc(OC)c(OC)c(OC)c2)cc1N.C[C@H](N)C(N)=O.Cl |
| InChI | InChI=1S/C19H20N2O4.C3H8N2O.ClH/c1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3;1-2(4)3(5)6;/h5-10H,21H2,1-4H3;2H,4H2,1H3,(H2,5,6);1H/b14-7-;;/t;2-;/m.0./s1 |
| InChIKey | GGYLQTUHBYILPM-ZCWBHTNOSA-N |
| XLogP | 2.61 |
| TPSA | 155.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|